C11H10F4N4O — CID 133338800
2,3,5,6-tetrafluoro-N-[1-(2-methoxyethyl)pyrazol-4-yl]pyridin-4-amine (PubChem CID 133338800) has the molecular formula C11H10F4N4O and a molecular weight of 290.22 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-[1-(2-methoxyethyl)pyrazol-4-yl]pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-[1-(2-methoxyethyl)pyrazol-4-yl]pyridin-4-amine |
|---|---|
| PubChem CID | 133338800 |
| Molecular Formula | C11H10F4N4O |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-[1-(2-methoxyethyl)pyrazol-4-yl]pyridin-4-amine |
| SMILES | COCCn1cc(Nc2c(F)c(F)nc(F)c2F)cn1 |
| InChI | InChI=1S/C11H10F4N4O/c1-20-3-2-19-5-6(4-16-19)17-9-7(12)10(14)18-11(15)8(9)13/h4-5H,2-3H2,1H3,(H,17,18) |
| InChIKey | DNBVZNMFYOPIEQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|