C13H13F4N3S — CID 133338865
N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 133338865) has the molecular formula C13H13F4N3S and a molecular weight of 319.33 g/mol. Its IUPAC name is N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 133338865 |
| Molecular Formula | C13H13F4N3S |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-[2-(4-ethyl-5-methyl-1,3-thiazol-2-yl)ethyl]-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | CCc1nc(CCNc2c(F)c(F)nc(F)c2F)sc1C |
| InChI | InChI=1S/C13H13F4N3S/c1-3-7-6(2)21-8(19-7)4-5-18-11-9(14)12(16)20-13(17)10(11)15/h3-5H2,1-2H3,(H,18,20) |
| InChIKey | YULFJMAOSZMVEI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|