C13H17F4N3O2S — CID 133338886
N-ethyl-N-[1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-yl]methanesulfonamide (PubChem CID 133338886) has the molecular formula C13H17F4N3O2S and a molecular weight of 355.36 g/mol. Its IUPAC name is N-ethyl-N-[1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-yl]methanesulfonamide.
| Compound Name | N-ethyl-N-[1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 133338886 |
| Molecular Formula | C13H17F4N3O2S |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-ethyl-N-[1-(2,3,5,6-tetrafluoro-4-pyridinyl)piperidin-4-yl]methanesulfonamide |
| SMILES | CCN(C1CCN(c2c(F)c(F)nc(F)c2F)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C13H17F4N3O2S/c1-3-20(23(2,21)22)8-4-6-19(7-5-8)11-9(14)12(16)18-13(17)10(11)15/h8H,3-7H2,1-2H3 |
| InChIKey | BNKGHNYBFHYNIX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|