C18H25N5O3 — CID 133339346
N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-methyl-5-nitropyridin-2-amine (PubChem CID 133339346) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-methyl-5-nitropyridin-2-amine.
| Compound Name | N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-methyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 133339346 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | N-[[1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]piperidin-4-yl]methyl]-4-methyl-5-nitropyridin-2-amine |
| SMILES | Cc1cc(NCC2CCN(Cc3nc(C)c(C)o3)CC2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H25N5O3/c1-12-8-17(20-10-16(12)23(24)25)19-9-15-4-6-22(7-5-15)11-18-21-13(2)14(3)26-18/h8,10,15H,4-7,9,11H2,1-3H3,(H,19,20) |
| InChIKey | ZJGDYDATVCFSGQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|