About 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide
4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 133339413) has the molecular formula C13H19F3N2O3S
and a molecular weight of 340.37 g/mol. Its IUPAC name is 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 133339413 |
| Molecular Formula | C13H19F3N2O3S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)(C)C(O)CNc1ccc(S(N)(=O)=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H19F3N2O3S/c1-12(2,3)11(19)7-18-8-4-5-10(22(17,20)21)9(6-8)13(14,15)16/h4-6,11,18-19H,7H2,1-3H3,(H2,17,20,21) |
| InChIKey | MUDKTSIDWMBVEJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide (CID 133339413) is 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide is CC(C)(C)C(O)CNc1ccc(S(N)(=O)=O)c(C(F)(F)F)c1.
What is the InChIKey of 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide?
The InChIKey is MUDKTSIDWMBVEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3N2O3S/c1-12(2,3)11(19)7-18-8-4-5-10(22(17,20)21)9(6-8)13(14,15)16/h4-6,11,18-19H,7H2,1-3H3,(H2,17,20,21).
What are the key properties of 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide?
4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide has a molecular weight of 340.37 g/mol, XLogP of 2.17, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-hydroxy-3,3-dimethylbutyl)amino]-2-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 133339413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).