C15H17N3O2S — CID 133339629
4-methyl-2-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]-5-nitropyridine (PubChem CID 133339629) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 4-methyl-2-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]-5-nitropyridine.
| Compound Name | 4-methyl-2-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]-5-nitropyridine |
|---|---|
| PubChem CID | 133339629 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 4-methyl-2-[2-(5-methylthiophen-2-yl)pyrrolidin-1-yl]-5-nitropyridine |
| SMILES | Cc1ccc(C2CCCN2c2cc(C)c([N+](=O)[O-])cn2)s1 |
| InChI | InChI=1S/C15H17N3O2S/c1-10-8-15(16-9-13(10)18(19)20)17-7-3-4-12(17)14-6-5-11(2)21-14/h5-6,8-9,12H,3-4,7H2,1-2H3 |
| InChIKey | QAVAKJJHAIKICX-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|