C19H20N4OS — CID 133339940
N-methyl-6-[[1-(3-methylthiophen-2-yl)-2-phenylethyl]amino]pyridazine-3-carboxamide (PubChem CID 133339940) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is N-methyl-6-[[1-(3-methylthiophen-2-yl)-2-phenylethyl]amino]pyridazine-3-carboxamide.
| Compound Name | N-methyl-6-[[1-(3-methylthiophen-2-yl)-2-phenylethyl]amino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 133339940 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-methyl-6-[[1-(3-methylthiophen-2-yl)-2-phenylethyl]amino]pyridazine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(NC(Cc2ccccc2)c2sccc2C)nn1 |
| InChI | InChI=1S/C19H20N4OS/c1-13-10-11-25-18(13)16(12-14-6-4-3-5-7-14)21-17-9-8-15(22-23-17)19(24)20-2/h3-11,16H,12H2,1-2H3,(H,20,24)(H,21,23) |
| InChIKey | BXGJKMIVMRUCFT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |