About phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone
phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone (PubChem CID 13334008) has the molecular formula C16H13NO2
and a molecular weight of 251.29 g/mol. Its IUPAC name is phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone.
Molecular Properties
| Compound Name | phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone |
| PubChem CID | 13334008 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone |
| SMILES | O=C(C1=NOC(c2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C16H13NO2/c18-16(13-9-5-2-6-10-13)14-11-15(19-17-14)12-7-3-1-4-8-12/h1-10,15H,11H2 |
| InChIKey | XEPPCVKKXLBYAR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone?
The IUPAC name of phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone (CID 13334008) is phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone.
What is the SMILES notation for phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone?
The canonical SMILES for phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone is O=C(C1=NOC(c2ccccc2)C1)c1ccccc1.
What is the InChIKey of phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone?
The InChIKey is XEPPCVKKXLBYAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO2/c18-16(13-9-5-2-6-10-13)14-11-15(19-17-14)12-7-3-1-4-8-12/h1-10,15H,11H2.
What are the key properties of phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone?
phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone has a molecular weight of 251.29 g/mol, XLogP of 3.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)methanone is sourced from PubChem (CID 13334008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).