About 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide
6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide (PubChem CID 133341088) has the molecular formula C18H20ClF2N5O
and a molecular weight of 395.84 g/mol. Its IUPAC name is 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide.
Molecular Properties
| Compound Name | 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide |
| PubChem CID | 133341088 |
| Molecular Formula | C18H20ClF2N5O |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide |
| SMILES | CCC(c1ccc(F)cc1F)N1CCN(c2nnc(Cl)cc2C(N)=O)CC1 |
| InChI | InChI=1S/C18H20ClF2N5O/c1-2-15(12-4-3-11(20)9-14(12)21)25-5-7-26(8-6-25)18-13(17(22)27)10-16(19)23-24-18/h3-4,9-10,15H,2,5-8H2,1H3,(H2,22,27) |
| InChIKey | FGUYYHPPGFIHQR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide?
The IUPAC name of 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide (CID 133341088) is 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide.
What is the SMILES notation for 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide?
The canonical SMILES for 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide is CCC(c1ccc(F)cc1F)N1CCN(c2nnc(Cl)cc2C(N)=O)CC1.
What is the InChIKey of 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide?
The InChIKey is FGUYYHPPGFIHQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClF2N5O/c1-2-15(12-4-3-11(20)9-14(12)21)25-5-7-26(8-6-25)18-13(17(22)27)10-16(19)23-24-18/h3-4,9-10,15H,2,5-8H2,1H3,(H2,22,27).
What are the key properties of 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide?
6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide has a molecular weight of 395.84 g/mol, XLogP of 2.78, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-[4-[1-(2,4-difluorophenyl)propyl]piperazin-1-yl]pyridazine-4-carboxamide is sourced from PubChem (CID 133341088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).