C15H21ClN4O2 — CID 133341301
6-chloro-3-[(3-ethoxyspiro[3.4]octan-1-yl)amino]pyridazine-4-carboxamide (PubChem CID 133341301) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is 6-chloro-3-[(3-ethoxyspiro[3.4]octan-1-yl)amino]pyridazine-4-carboxamide.
| Compound Name | 6-chloro-3-[(3-ethoxyspiro[3.4]octan-1-yl)amino]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 133341301 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 6-chloro-3-[(3-ethoxyspiro[3.4]octan-1-yl)amino]pyridazine-4-carboxamide |
| SMILES | CCOC1CC(Nc2nnc(Cl)cc2C(N)=O)C12CCCC2 |
| InChI | InChI=1S/C15H21ClN4O2/c1-2-22-11-8-10(15(11)5-3-4-6-15)18-14-9(13(17)21)7-12(16)19-20-14/h7,10-11H,2-6,8H2,1H3,(H2,17,21)(H,18,20) |
| InChIKey | LMRFOXDMVCPBNW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |