C14H19ClF4N4 — CID 133342926
4-chloro-5-ethyl-2-methyl-6-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyrimidine (PubChem CID 133342926) has the molecular formula C14H19ClF4N4 and a molecular weight of 354.78 g/mol. Its IUPAC name is 4-chloro-5-ethyl-2-methyl-6-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyrimidine.
| Compound Name | 4-chloro-5-ethyl-2-methyl-6-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 133342926 |
| Molecular Formula | C14H19ClF4N4 |
| Molecular Weight | 354.78 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 4-chloro-5-ethyl-2-methyl-6-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyrimidine |
| SMILES | CCc1c(Cl)nc(C)nc1N1CCN(CC(F)(F)C(F)F)CC1 |
| InChI | InChI=1S/C14H19ClF4N4/c1-3-10-11(15)20-9(2)21-12(10)23-6-4-22(5-7-23)8-14(18,19)13(16)17/h13H,3-8H2,1-2H3 |
| InChIKey | ZTUYGMGKOCXOIY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.78 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|