About 4-ethyl-2-methyloxolane
4-ethyl-2-methyloxolane (PubChem CID 13334303) has the molecular formula C7H14O
and a molecular weight of 114.19 g/mol. Its IUPAC name is 4-ethyl-2-methyloxolane.
Molecular Properties
| Compound Name | 4-ethyl-2-methyloxolane |
| PubChem CID | 13334303 |
| Molecular Formula | C7H14O |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.10 |
| IUPAC Name | 4-ethyl-2-methyloxolane |
| SMILES | CCC1COC(C)C1 |
| InChI | InChI=1S/C7H14O/c1-3-7-4-6(2)8-5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | NYVCWEULJZVOKS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-2-methyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methyloxolane?
The IUPAC name of 4-ethyl-2-methyloxolane (CID 13334303) is 4-ethyl-2-methyloxolane.
What is the SMILES notation for 4-ethyl-2-methyloxolane?
The canonical SMILES for 4-ethyl-2-methyloxolane is CCC1COC(C)C1.
What is the InChIKey of 4-ethyl-2-methyloxolane?
The InChIKey is NYVCWEULJZVOKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O/c1-3-7-4-6(2)8-5-7/h6-7H,3-5H2,1-2H3.
What are the key properties of 4-ethyl-2-methyloxolane?
4-ethyl-2-methyloxolane has a molecular weight of 114.19 g/mol, XLogP of 1.82, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methyloxolane is sourced from PubChem (CID 13334303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).