C12H15F3N4O2 — CID 133343060
4-methyl-5-nitro-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]pyridin-2-amine (PubChem CID 133343060) has the molecular formula C12H15F3N4O2 and a molecular weight of 304.27 g/mol. Its IUPAC name is 4-methyl-5-nitro-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]pyridin-2-amine.
| Compound Name | 4-methyl-5-nitro-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 133343060 |
| Molecular Formula | C12H15F3N4O2 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-methyl-5-nitro-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]pyridin-2-amine |
| SMILES | Cc1cc(NC2CCN(CC(F)(F)F)C2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15F3N4O2/c1-8-4-11(16-5-10(8)19(20)21)17-9-2-3-18(6-9)7-12(13,14)15/h4-5,9H,2-3,6-7H2,1H3,(H,16,17) |
| InChIKey | SYTIBYMSCQXROB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|