C11H16ClN3O3S — CID 133344208
4-chloro-2-methyl-5-[[1-(methylsulfonylmethyl)cyclopropyl]methylamino]pyridazin-3-one (PubChem CID 133344208) has the molecular formula C11H16ClN3O3S and a molecular weight of 305.79 g/mol. Its IUPAC name is 4-chloro-2-methyl-5-[[1-(methylsulfonylmethyl)cyclopropyl]methylamino]pyridazin-3-one.
| Compound Name | 4-chloro-2-methyl-5-[[1-(methylsulfonylmethyl)cyclopropyl]methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 133344208 |
| Molecular Formula | C11H16ClN3O3S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-chloro-2-methyl-5-[[1-(methylsulfonylmethyl)cyclopropyl]methylamino]pyridazin-3-one |
| SMILES | Cn1ncc(NCC2(CS(C)(=O)=O)CC2)c(Cl)c1=O |
| InChI | InChI=1S/C11H16ClN3O3S/c1-15-10(16)9(12)8(5-14-15)13-6-11(3-4-11)7-19(2,17)18/h5,13H,3-4,6-7H2,1-2H3 |
| InChIKey | CKIVHEXTSBAXBY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |