C18H29ClN4O2 — CID 133344752
5-chloro-2,4-bis(3-ethoxypiperidin-1-yl)pyrimidine (PubChem CID 133344752) has the molecular formula C18H29ClN4O2 and a molecular weight of 368.91 g/mol. Its IUPAC name is 5-chloro-2,4-bis(3-ethoxypiperidin-1-yl)pyrimidine.
| Compound Name | 5-chloro-2,4-bis(3-ethoxypiperidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 133344752 |
| Molecular Formula | C18H29ClN4O2 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 5-chloro-2,4-bis(3-ethoxypiperidin-1-yl)pyrimidine |
| SMILES | CCOC1CCCN(c2ncc(Cl)c(N3CCCC(OCC)C3)n2)C1 |
| InChI | InChI=1S/C18H29ClN4O2/c1-3-24-14-7-5-9-22(12-14)17-16(19)11-20-18(21-17)23-10-6-8-15(13-23)25-4-2/h11,14-15H,3-10,12-13H2,1-2H3 |
| InChIKey | OQYKPHOHCKRGQE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |