C20H21N3O2S — CID 133345318
5-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-3-phenyl-1,2,4-thiadiazole (PubChem CID 133345318) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 5-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-3-phenyl-1,2,4-thiadiazole.
| Compound Name | 5-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-3-phenyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 133345318 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 5-[2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-3-phenyl-1,2,4-thiadiazole |
| SMILES | COc1ccc(C2CCCN2c2nc(-c3ccccc3)ns2)c(OC)c1 |
| InChI | InChI=1S/C20H21N3O2S/c1-24-15-10-11-16(18(13-15)25-2)17-9-6-12-23(17)20-21-19(22-26-20)14-7-4-3-5-8-14/h3-5,7-8,10-11,13,17H,6,9,12H2,1-2H3 |
| InChIKey | KFJTUJYWDYJEKO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |