C19H24BrN3O — CID 133345750
5-bromo-N-[[4-(1-phenylethylamino)oxan-4-yl]methyl]pyridin-2-amine (PubChem CID 133345750) has the molecular formula C19H24BrN3O and a molecular weight of 390.33 g/mol. Its IUPAC name is 5-bromo-N-[[4-(1-phenylethylamino)oxan-4-yl]methyl]pyridin-2-amine.
| Compound Name | 5-bromo-N-[[4-(1-phenylethylamino)oxan-4-yl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 133345750 |
| Molecular Formula | C19H24BrN3O |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 5-bromo-N-[[4-(1-phenylethylamino)oxan-4-yl]methyl]pyridin-2-amine |
| SMILES | CC(NC1(CNc2ccc(Br)cn2)CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C19H24BrN3O/c1-15(16-5-3-2-4-6-16)23-19(9-11-24-12-10-19)14-22-18-8-7-17(20)13-21-18/h2-8,13,15,23H,9-12,14H2,1H3,(H,21,22) |
| InChIKey | RBGLIZMVOSLXNS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |