C17H19F3N4OS — CID 133346959
2,2,2-trifluoro-1-[4-[(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)methyl]piperidin-1-yl]ethanone (PubChem CID 133346959) has the molecular formula C17H19F3N4OS and a molecular weight of 384.43 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)methyl]piperidin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-[(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)methyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 133346959 |
| Molecular Formula | C17H19F3N4OS |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-ylamino)methyl]piperidin-1-yl]ethanone |
| SMILES | O=C(N1CCC(CNc2ncnc3sc4c(c23)CCC4)CC1)C(F)(F)F |
| InChI | InChI=1S/C17H19F3N4OS/c18-17(19,20)16(25)24-6-4-10(5-7-24)8-21-14-13-11-2-1-3-12(11)26-15(13)23-9-22-14/h9-10H,1-8H2,(H,21,22,23) |
| InChIKey | HAKOOVFILPONHI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |