C22H24N4O2 — CID 133347562
2,3-dihydroindol-1-yl-[2-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propylamino]-3-pyridinyl]methanone (PubChem CID 133347562) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[2-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propylamino]-3-pyridinyl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[2-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propylamino]-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 133347562 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[2-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propylamino]-3-pyridinyl]methanone |
| SMILES | Cc1noc(C)c1CCCNc1ncccc1C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C22H24N4O2/c1-15-18(16(2)28-25-15)8-5-12-23-21-19(9-6-13-24-21)22(27)26-14-11-17-7-3-4-10-20(17)26/h3-4,6-7,9-10,13H,5,8,11-12,14H2,1-2H3,(H,23,24) |
| InChIKey | PXTLJPBKOBSFPK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|