C15H23ClN4O2S — CID 133348560
6-chloro-N-(1-cyclopropylsulfonylpiperidin-4-yl)-2-ethyl-5-methylpyrimidin-4-amine (PubChem CID 133348560) has the molecular formula C15H23ClN4O2S and a molecular weight of 358.90 g/mol. Its IUPAC name is 6-chloro-N-(1-cyclopropylsulfonylpiperidin-4-yl)-2-ethyl-5-methylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(1-cyclopropylsulfonylpiperidin-4-yl)-2-ethyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133348560 |
| Molecular Formula | C15H23ClN4O2S |
| Molecular Weight | 358.90 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 6-chloro-N-(1-cyclopropylsulfonylpiperidin-4-yl)-2-ethyl-5-methylpyrimidin-4-amine |
| SMILES | CCc1nc(Cl)c(C)c(NC2CCN(S(=O)(=O)C3CC3)CC2)n1 |
| InChI | InChI=1S/C15H23ClN4O2S/c1-3-13-18-14(16)10(2)15(19-13)17-11-6-8-20(9-7-11)23(21,22)12-4-5-12/h11-12H,3-9H2,1-2H3,(H,17,18,19) |
| InChIKey | AIDNGYUFINYVCA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.90 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |