C17H21ClN4O2S — CID 133349112
N-[2-[[2-(3-chlorophenyl)-5,6,7,8-tetrahydroquinazolin-4-yl]amino]ethyl]methanesulfonamide (PubChem CID 133349112) has the molecular formula C17H21ClN4O2S and a molecular weight of 380.90 g/mol. Its IUPAC name is N-[2-[[2-(3-chlorophenyl)-5,6,7,8-tetrahydroquinazolin-4-yl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[2-(3-chlorophenyl)-5,6,7,8-tetrahydroquinazolin-4-yl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 133349112 |
| Molecular Formula | C17H21ClN4O2S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-[2-[[2-(3-chlorophenyl)-5,6,7,8-tetrahydroquinazolin-4-yl]amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNc1nc(-c2cccc(Cl)c2)nc2c1CCCC2 |
| InChI | InChI=1S/C17H21ClN4O2S/c1-25(23,24)20-10-9-19-17-14-7-2-3-8-15(14)21-16(22-17)12-5-4-6-13(18)11-12/h4-6,11,20H,2-3,7-10H2,1H3,(H,19,21,22) |
| InChIKey | FSNZTOSFSVJRGJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|