C11H15F4N3S — CID 133351981
5-methyl-2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]-1,3-thiazole (PubChem CID 133351981) has the molecular formula C11H15F4N3S and a molecular weight of 297.32 g/mol. Its IUPAC name is 5-methyl-2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]-1,3-thiazole.
| Compound Name | 5-methyl-2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 133351981 |
| Molecular Formula | C11H15F4N3S |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 5-methyl-2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]-1,3-thiazole |
| SMILES | Cc1cnc(N2CCN(CC(F)(F)C(F)F)CC2)s1 |
| InChI | InChI=1S/C11H15F4N3S/c1-8-6-16-10(19-8)18-4-2-17(3-5-18)7-11(14,15)9(12)13/h6,9H,2-5,7H2,1H3 |
| InChIKey | IUTWMLUEYUBUKB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|