C15H20N4O2S — CID 133352235
3-(methoxymethyl)-5-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2,4-thiadiazole (PubChem CID 133352235) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 3-(methoxymethyl)-5-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2,4-thiadiazole.
| Compound Name | 3-(methoxymethyl)-5-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 133352235 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-(methoxymethyl)-5-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2,4-thiadiazole |
| SMILES | COCc1nsc(N2CCN(c3ccc(OC)cc3)CC2)n1 |
| InChI | InChI=1S/C15H20N4O2S/c1-20-11-14-16-15(22-17-14)19-9-7-18(8-10-19)12-3-5-13(21-2)6-4-12/h3-6H,7-11H2,1-2H3 |
| InChIKey | JKZBADIZXMJPRB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|