About N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine
N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine (PubChem CID 133352657) has the molecular formula C15H21N3OS
and a molecular weight of 291.42 g/mol. Its IUPAC name is N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine.
Molecular Properties
| Compound Name | N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine |
| PubChem CID | 133352657 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine |
| SMILES | CC(CNc1ccnc2ccsc12)N1CCOCC1C |
| InChI | InChI=1S/C15H21N3OS/c1-11(18-6-7-19-10-12(18)2)9-17-13-3-5-16-14-4-8-20-15(13)14/h3-5,8,11-12H,6-7,9-10H2,1-2H3,(H,16,17) |
| InChIKey | LTFDDWSPQKFKDF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine?
The IUPAC name of N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine (CID 133352657) is N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine.
What is the SMILES notation for N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine?
The canonical SMILES for N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine is CC(CNc1ccnc2ccsc12)N1CCOCC1C.
What is the InChIKey of N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine?
The InChIKey is LTFDDWSPQKFKDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3OS/c1-11(18-6-7-19-10-12(18)2)9-17-13-3-5-16-14-4-8-20-15(13)14/h3-5,8,11-12H,6-7,9-10H2,1-2H3,(H,16,17).
What are the key properties of N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine?
N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine has a molecular weight of 291.42 g/mol, XLogP of 2.82, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3-methylmorpholin-4-yl)propyl]thieno[3,2-b]pyridin-7-amine is sourced from PubChem (CID 133352657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).