C16H16ClN3O2 — CID 133353209
1-[(7-chloroquinazolin-4-yl)amino]-2-(5-methylfuran-2-yl)propan-2-ol (PubChem CID 133353209) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is 1-[(7-chloroquinazolin-4-yl)amino]-2-(5-methylfuran-2-yl)propan-2-ol.
| Compound Name | 1-[(7-chloroquinazolin-4-yl)amino]-2-(5-methylfuran-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 133353209 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 1-[(7-chloroquinazolin-4-yl)amino]-2-(5-methylfuran-2-yl)propan-2-ol |
| SMILES | Cc1ccc(C(C)(O)CNc2ncnc3cc(Cl)ccc23)o1 |
| InChI | InChI=1S/C16H16ClN3O2/c1-10-3-6-14(22-10)16(2,21)8-18-15-12-5-4-11(17)7-13(12)19-9-20-15/h3-7,9,21H,8H2,1-2H3,(H,18,19,20) |
| InChIKey | WRQXCLBFJCRTNQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |