C15H16N10 — CID 133354402
N-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine (PubChem CID 133354402) has the molecular formula C15H16N10 and a molecular weight of 336.36 g/mol. Its IUPAC name is N-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine.
| Compound Name | N-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133354402 |
| Molecular Formula | C15H16N10 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine |
| SMILES | Cc1cc(NCCNc2nnnn2-c2ccccc2)n2ncnc2n1 |
| InChI | InChI=1S/C15H16N10/c1-11-9-13(25-14(20-11)18-10-19-25)16-7-8-17-15-21-22-23-24(15)12-5-3-2-4-6-12/h2-6,9-10,16H,7-8H2,1H3,(H,17,21,23) |
| InChIKey | YCINUHNJCLNBBX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 110.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|