C17H17N3O5S — CID 133355451
methyl 2-[3-(3-methyl-4-nitroanilino)-2-oxopyrrolidin-1-yl]thiophene-3-carboxylate (PubChem CID 133355451) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is methyl 2-[3-(3-methyl-4-nitroanilino)-2-oxopyrrolidin-1-yl]thiophene-3-carboxylate.
| Compound Name | methyl 2-[3-(3-methyl-4-nitroanilino)-2-oxopyrrolidin-1-yl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 133355451 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | methyl 2-[3-(3-methyl-4-nitroanilino)-2-oxopyrrolidin-1-yl]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1N1CCC(Nc2ccc([N+](=O)[O-])c(C)c2)C1=O |
| InChI | InChI=1S/C17H17N3O5S/c1-10-9-11(3-4-14(10)20(23)24)18-13-5-7-19(15(13)21)16-12(6-8-26-16)17(22)25-2/h3-4,6,8-9,13,18H,5,7H2,1-2H3 |
| InChIKey | GNKNOMQOUKOCRY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|