C14H10IN3O — CID 133355817
6-(2-iodo-5-methylphenoxy)pyrido[2,3-b]pyrazine (PubChem CID 133355817) has the molecular formula C14H10IN3O and a molecular weight of 363.16 g/mol. Its IUPAC name is 6-(2-iodo-5-methylphenoxy)pyrido[2,3-b]pyrazine.
| Compound Name | 6-(2-iodo-5-methylphenoxy)pyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 133355817 |
| Molecular Formula | C14H10IN3O |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 6-(2-iodo-5-methylphenoxy)pyrido[2,3-b]pyrazine |
| SMILES | Cc1ccc(I)c(Oc2ccc3nccnc3n2)c1 |
| InChI | InChI=1S/C14H10IN3O/c1-9-2-3-10(15)12(8-9)19-13-5-4-11-14(18-13)17-7-6-16-11/h2-8H,1H3 |
| InChIKey | FDHZWCGNTGNNFN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|