C21H23N5OS — CID 133356003
2-[1-(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperidin-3-yl]acetamide (PubChem CID 133356003) has the molecular formula C21H23N5OS and a molecular weight of 393.52 g/mol. Its IUPAC name is 2-[1-(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperidin-3-yl]acetamide.
| Compound Name | 2-[1-(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 133356003 |
| Molecular Formula | C21H23N5OS |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 2-[1-(10-pyridin-3-yl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperidin-3-yl]acetamide |
| SMILES | NC(=O)CC1CCCN(c2nc(-c3cccnc3)nc3sc4c(c23)CCC4)C1 |
| InChI | InChI=1S/C21H23N5OS/c22-17(27)10-13-4-3-9-26(12-13)20-18-15-6-1-7-16(15)28-21(18)25-19(24-20)14-5-2-8-23-11-14/h2,5,8,11,13H,1,3-4,6-7,9-10,12H2,(H2,22,27) |
| InChIKey | KXAVLCQWQYBOMF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |