C19H25N5O3 — CID 133356281
1-(1,3-dimethyl-4-nitropyrazol-5-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 133356281) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-(1,3-dimethyl-4-nitropyrazol-5-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-(1,3-dimethyl-4-nitropyrazol-5-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133356281 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-(1,3-dimethyl-4-nitropyrazol-5-yl)-N-[(4-methylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2CCN(c3c([N+](=O)[O-])c(C)nn3C)CC2)cc1 |
| InChI | InChI=1S/C19H25N5O3/c1-13-4-6-15(7-5-13)12-20-18(25)16-8-10-23(11-9-16)19-17(24(26)27)14(2)21-22(19)3/h4-7,16H,8-12H2,1-3H3,(H,20,25) |
| InChIKey | AFXVUHZOCXWCND-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|