C17H15F2N3O3S — CID 133358492
N-(3,5-difluorophenyl)-6-[1-(furan-2-yl)ethylamino]pyridine-3-sulfonamide (PubChem CID 133358492) has the molecular formula C17H15F2N3O3S and a molecular weight of 379.39 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-6-[1-(furan-2-yl)ethylamino]pyridine-3-sulfonamide.
| Compound Name | N-(3,5-difluorophenyl)-6-[1-(furan-2-yl)ethylamino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133358492 |
| Molecular Formula | C17H15F2N3O3S |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | N-(3,5-difluorophenyl)-6-[1-(furan-2-yl)ethylamino]pyridine-3-sulfonamide |
| SMILES | CC(Nc1ccc(S(=O)(=O)Nc2cc(F)cc(F)c2)cn1)c1ccco1 |
| InChI | InChI=1S/C17H15F2N3O3S/c1-11(16-3-2-6-25-16)21-17-5-4-15(10-20-17)26(23,24)22-14-8-12(18)7-13(19)9-14/h2-11,22H,1H3,(H,20,21) |
| InChIKey | SIKVBVNYVLJCFM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |