C14H14ClN5 — CID 133359322
N-[3-(1H-benzimidazol-2-yl)propyl]-6-chloropyrazin-2-amine (PubChem CID 133359322) has the molecular formula C14H14ClN5 and a molecular weight of 287.75 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-6-chloropyrazin-2-amine.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-6-chloropyrazin-2-amine |
|---|---|
| PubChem CID | 133359322 |
| Molecular Formula | C14H14ClN5 |
| Molecular Weight | 287.75 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-6-chloropyrazin-2-amine |
| SMILES | Clc1cncc(NCCCc2nc3ccccc3[nH]2)n1 |
| InChI | InChI=1S/C14H14ClN5/c15-12-8-16-9-14(20-12)17-7-3-6-13-18-10-4-1-2-5-11(10)19-13/h1-2,4-5,8-9H,3,6-7H2,(H,17,20)(H,18,19) |
| InChIKey | GWGOXOJZFXNBOD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.75 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|