About 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride
2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride (PubChem CID 13336001) has the molecular formula C24H25BrClNO4
and a molecular weight of 506.82 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride |
| PubChem CID | 13336001 |
| Molecular Formula | C24H25BrClNO4 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride |
| SMILES | Cc1c(-c2ccccc2)oc2c(C(=O)OCCN3CCCCC3)cc(Br)cc2c1=O.Cl |
| InChI | InChI=1S/C24H24BrNO4.ClH/c1-16-21(27)19-14-18(25)15-20(23(19)30-22(16)17-8-4-2-5-9-17)24(28)29-13-12-26-10-6-3-7-11-26;/h2,4-5,8-9,14-15H,3,6-7,10-13H2,1H3;1H |
| InChIKey | COOXZYNKSQKKCX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride?
The IUPAC name of 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride (CID 13336001) is 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride.
What is the SMILES notation for 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride?
The canonical SMILES for 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride is Cc1c(-c2ccccc2)oc2c(C(=O)OCCN3CCCCC3)cc(Br)cc2c1=O.Cl.
What is the InChIKey of 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride?
The InChIKey is COOXZYNKSQKKCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24BrNO4.ClH/c1-16-21(27)19-14-18(25)15-20(23(19)30-22(16)17-8-4-2-5-9-17)24(28)29-13-12-26-10-6-3-7-11-26;/h2,4-5,8-9,14-15H,3,6-7,10-13H2,1H3;1H.
What are the key properties of 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride?
2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride has a molecular weight of 506.82 g/mol, XLogP of 5.60, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 6-bromo-3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride is sourced from PubChem (CID 13336001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).