C14H13ClN4 — CID 133360211
N-[1-(1H-benzimidazol-2-yl)ethyl]-2-chloropyridin-4-amine (PubChem CID 133360211) has the molecular formula C14H13ClN4 and a molecular weight of 272.74 g/mol. Its IUPAC name is N-[1-(1H-benzimidazol-2-yl)ethyl]-2-chloropyridin-4-amine.
| Compound Name | N-[1-(1H-benzimidazol-2-yl)ethyl]-2-chloropyridin-4-amine |
|---|---|
| PubChem CID | 133360211 |
| Molecular Formula | C14H13ClN4 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-[1-(1H-benzimidazol-2-yl)ethyl]-2-chloropyridin-4-amine |
| SMILES | CC(Nc1ccnc(Cl)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H13ClN4/c1-9(17-10-6-7-16-13(15)8-10)14-18-11-4-2-3-5-12(11)19-14/h2-9H,1H3,(H,16,17)(H,18,19) |
| InChIKey | IFMXSWUPLAMAHY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|