C17H16ClN3O — CID 133360947
2-chloro-N-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]pyridin-4-amine (PubChem CID 133360947) has the molecular formula C17H16ClN3O and a molecular weight of 313.79 g/mol. Its IUPAC name is 2-chloro-N-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]pyridin-4-amine |
|---|---|
| PubChem CID | 133360947 |
| Molecular Formula | C17H16ClN3O |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-chloro-N-[2-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethyl]pyridin-4-amine |
| SMILES | Cc1ccc(-c2nc(CCNc3ccnc(Cl)c3)co2)cc1 |
| InChI | InChI=1S/C17H16ClN3O/c1-12-2-4-13(5-3-12)17-21-15(11-22-17)7-8-19-14-6-9-20-16(18)10-14/h2-6,9-11H,7-8H2,1H3,(H,19,20) |
| InChIKey | YJPRBMCQTVEEPZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|