C14H15N3O — CID 133361794
N-(4-methoxy-2,3-dihydro-1H-inden-1-yl)pyrazin-2-amine (PubChem CID 133361794) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is N-(4-methoxy-2,3-dihydro-1H-inden-1-yl)pyrazin-2-amine.
| Compound Name | N-(4-methoxy-2,3-dihydro-1H-inden-1-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 133361794 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-(4-methoxy-2,3-dihydro-1H-inden-1-yl)pyrazin-2-amine |
| SMILES | COc1cccc2c1CCC2Nc1cnccn1 |
| InChI | InChI=1S/C14H15N3O/c1-18-13-4-2-3-10-11(13)5-6-12(10)17-14-9-15-7-8-16-14/h2-4,7-9,12H,5-6H2,1H3,(H,16,17) |
| InChIKey | HCWYOYITYUGZPY-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |