C17H17Cl2N3O2 — CID 133362039
2-[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]-N-methylpyridine-3-carboxamide (PubChem CID 133362039) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is 2-[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]-N-methylpyridine-3-carboxamide.
| Compound Name | 2-[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133362039 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 2-[3-(3,4-dichlorophenoxy)pyrrolidin-1-yl]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1cccnc1N1CCC(Oc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-20-17(23)13-3-2-7-21-16(13)22-8-6-12(10-22)24-11-4-5-14(18)15(19)9-11/h2-5,7,9,12H,6,8,10H2,1H3,(H,20,23) |
| InChIKey | BPLDMSIUEFVKHR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |