C15H13F3N4 — CID 133362287
N-cyclopent-3-en-1-yl-2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 133362287) has the molecular formula C15H13F3N4 and a molecular weight of 306.29 g/mol. Its IUPAC name is N-cyclopent-3-en-1-yl-2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-cyclopent-3-en-1-yl-2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 133362287 |
| Molecular Formula | C15H13F3N4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | N-cyclopent-3-en-1-yl-2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cc(NC2CC=CC2)nc(-c2ccncc2)n1 |
| InChI | InChI=1S/C15H13F3N4/c16-15(17,18)12-9-13(20-11-3-1-2-4-11)22-14(21-12)10-5-7-19-8-6-10/h1-2,5-9,11H,3-4H2,(H,20,21,22) |
| InChIKey | NUDBLPAFXHWIAA-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|