C18H21FN2O3 — CID 133362438
4-(3,5-dimethoxyphenyl)-1-(6-fluoro-2-pyridinyl)piperidin-4-ol (PubChem CID 133362438) has the molecular formula C18H21FN2O3 and a molecular weight of 332.38 g/mol. Its IUPAC name is 4-(3,5-dimethoxyphenyl)-1-(6-fluoro-2-pyridinyl)piperidin-4-ol.
| Compound Name | 4-(3,5-dimethoxyphenyl)-1-(6-fluoro-2-pyridinyl)piperidin-4-ol |
|---|---|
| PubChem CID | 133362438 |
| Molecular Formula | C18H21FN2O3 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 4-(3,5-dimethoxyphenyl)-1-(6-fluoro-2-pyridinyl)piperidin-4-ol |
| SMILES | COc1cc(OC)cc(C2(O)CCN(c3cccc(F)n3)CC2)c1 |
| InChI | InChI=1S/C18H21FN2O3/c1-23-14-10-13(11-15(12-14)24-2)18(22)6-8-21(9-7-18)17-5-3-4-16(19)20-17/h3-5,10-12,22H,6-9H2,1-2H3 |
| InChIKey | IIZGFHVESIZVRT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|