C12H14N4O2 — CID 133362759
methyl 1-(3-cyanopyrazin-2-yl)-3-methylpyrrolidine-3-carboxylate (PubChem CID 133362759) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is methyl 1-(3-cyanopyrazin-2-yl)-3-methylpyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(3-cyanopyrazin-2-yl)-3-methylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 133362759 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | methyl 1-(3-cyanopyrazin-2-yl)-3-methylpyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1(C)CCN(c2nccnc2C#N)C1 |
| InChI | InChI=1S/C12H14N4O2/c1-12(11(17)18-2)3-6-16(8-12)10-9(7-13)14-4-5-15-10/h4-5H,3,6,8H2,1-2H3 |
| InChIKey | YYHDPWDXIBIURW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 79.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |