C21H20F3N3O — CID 133362920
4-(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-3-(trifluoromethyl)benzonitrile (PubChem CID 133362920) has the molecular formula C21H20F3N3O and a molecular weight of 387.41 g/mol. Its IUPAC name is 4-(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 133362920 |
| Molecular Formula | C21H20F3N3O |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 4-(4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl)-3-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(N2CC3OCCN(Cc4ccccc4)C3C2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H20F3N3O/c22-21(23,24)17-10-16(11-25)6-7-18(17)27-13-19-20(14-27)28-9-8-26(19)12-15-4-2-1-3-5-15/h1-7,10,19-20H,8-9,12-14H2 |
| InChIKey | VBMVOUOYRYYSEF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |