About 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine
3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine (PubChem CID 133363047) has the molecular formula C20H21Cl2N5O
and a molecular weight of 418.33 g/mol. Its IUPAC name is 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine.
Molecular Properties
| Compound Name | 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine |
| PubChem CID | 133363047 |
| Molecular Formula | C20H21Cl2N5O |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine |
| SMILES | Cc1ccn(-c2ccc(N3CCC(OCc4ccc(Cl)c(Cl)c4)CC3)nn2)n1 |
| InChI | InChI=1S/C20H21Cl2N5O/c1-14-6-11-27(25-14)20-5-4-19(23-24-20)26-9-7-16(8-10-26)28-13-15-2-3-17(21)18(22)12-15/h2-6,11-12,16H,7-10,13H2,1H3 |
| InChIKey | QMUQHDRHVMKFDE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine?
The IUPAC name of 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine (CID 133363047) is 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine.
What is the SMILES notation for 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine?
The canonical SMILES for 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine is Cc1ccn(-c2ccc(N3CCC(OCc4ccc(Cl)c(Cl)c4)CC3)nn2)n1.
What is the InChIKey of 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine?
The InChIKey is QMUQHDRHVMKFDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21Cl2N5O/c1-14-6-11-27(25-14)20-5-4-19(23-24-20)26-9-7-16(8-10-26)28-13-15-2-3-17(21)18(22)12-15/h2-6,11-12,16H,7-10,13H2,1H3.
What are the key properties of 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine?
3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine has a molecular weight of 418.33 g/mol, XLogP of 4.46, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(3,4-dichlorophenyl)methoxy]piperidin-1-yl]-6-(3-methylpyrazol-1-yl)pyridazine is sourced from PubChem (CID 133363047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).