C13H12F3N3OS — CID 133363523
2-thiophen-2-yl-4-[4-(trifluoromethyl)pyrimidin-2-yl]morpholine (PubChem CID 133363523) has the molecular formula C13H12F3N3OS and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-thiophen-2-yl-4-[4-(trifluoromethyl)pyrimidin-2-yl]morpholine.
| Compound Name | 2-thiophen-2-yl-4-[4-(trifluoromethyl)pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 133363523 |
| Molecular Formula | C13H12F3N3OS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-thiophen-2-yl-4-[4-(trifluoromethyl)pyrimidin-2-yl]morpholine |
| SMILES | FC(F)(F)c1ccnc(N2CCOC(c3cccs3)C2)n1 |
| InChI | InChI=1S/C13H12F3N3OS/c14-13(15,16)11-3-4-17-12(18-11)19-5-6-20-9(8-19)10-2-1-7-21-10/h1-4,7,9H,5-6,8H2 |
| InChIKey | KBMOESXHMANOMR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |