C13H17ClN2O3S — CID 133364786
methyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ylamino)-4-chloro-1,3-thiazole-5-carboxylate (PubChem CID 133364786) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is methyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ylamino)-4-chloro-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ylamino)-4-chloro-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 133364786 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | methyl 2-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-ylamino)-4-chloro-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(NC2CCCC3OCCC23)nc1Cl |
| InChI | InChI=1S/C13H17ClN2O3S/c1-18-12(17)10-11(14)16-13(20-10)15-8-3-2-4-9-7(8)5-6-19-9/h7-9H,2-6H2,1H3,(H,15,16) |
| InChIKey | JVYGIAZLLFGUJB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |