C20H17BrN2O3S — CID 1333667
N-[4-[(4-bromophenyl)sulfamoyl]phenyl]-4-methylbenzamide (PubChem CID 1333667) has the molecular formula C20H17BrN2O3S and a molecular weight of 445.34 g/mol. Its IUPAC name is N-[4-[(4-bromophenyl)sulfamoyl]phenyl]-4-methylbenzamide.
| Compound Name | N-[4-[(4-bromophenyl)sulfamoyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 1333667 |
| Molecular Formula | C20H17BrN2O3S |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | N-[4-[(4-bromophenyl)sulfamoyl]phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)Nc3ccc(Br)cc3)cc2)cc1 |
| InChI | InChI=1S/C20H17BrN2O3S/c1-14-2-4-15(5-3-14)20(24)22-17-10-12-19(13-11-17)27(25,26)23-18-8-6-16(21)7-9-18/h2-13,23H,1H3,(H,22,24) |
| InChIKey | LWJVCOCFORHYPM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |