C18H16F3N7O — CID 133367053
N-[phenyl-(5-propyl-1,2,4-oxadiazol-3-yl)methyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133367053) has the molecular formula C18H16F3N7O and a molecular weight of 403.37 g/mol. Its IUPAC name is N-[phenyl-(5-propyl-1,2,4-oxadiazol-3-yl)methyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-[phenyl-(5-propyl-1,2,4-oxadiazol-3-yl)methyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133367053 |
| Molecular Formula | C18H16F3N7O |
| Molecular Weight | 403.37 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-[phenyl-(5-propyl-1,2,4-oxadiazol-3-yl)methyl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CCCc1nc(C(Nc2ccc3nnc(C(F)(F)F)n3n2)c2ccccc2)no1 |
| InChI | InChI=1S/C18H16F3N7O/c1-2-6-14-23-16(27-29-14)15(11-7-4-3-5-8-11)22-12-9-10-13-24-25-17(18(19,20)21)28(13)26-12/h3-5,7-10,15H,2,6H2,1H3,(H,22,26) |
| InChIKey | VZYQTBQBFOYLBA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.37 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |