C12H16F3N5 — CID 133367648
N-butyl-7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133367648) has the molecular formula C12H16F3N5 and a molecular weight of 287.29 g/mol. Its IUPAC name is N-butyl-7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-butyl-7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133367648 |
| Molecular Formula | C12H16F3N5 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-butyl-7,8-dimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | CCCCNc1nn2c(C(F)(F)F)nnc2c(C)c1C |
| InChI | InChI=1S/C12H16F3N5/c1-4-5-6-16-9-7(2)8(3)10-17-18-11(12(13,14)15)20(10)19-9/h4-6H2,1-3H3,(H,16,19) |
| InChIKey | ZTGLCFWNBRKTSF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|