C15H17F3N6O — CID 133367961
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N,7,8-trimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133367961) has the molecular formula C15H17F3N6O and a molecular weight of 354.34 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N,7,8-trimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N,7,8-trimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133367961 |
| Molecular Formula | C15H17F3N6O |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N,7,8-trimethyl-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | Cc1noc(C)c1CN(C)c1nn2c(C(F)(F)F)nnc2c(C)c1C |
| InChI | InChI=1S/C15H17F3N6O/c1-7-8(2)13(23(5)6-11-9(3)22-25-10(11)4)21-24-12(7)19-20-14(24)15(16,17)18/h6H2,1-5H3 |
| InChIKey | FRLWIBMMBCEEHQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 72.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |