C23H22N4O2 — CID 133368162
4-[[4-(8-methoxy-2-methylquinolin-4-yl)-2-oxopiperazin-1-yl]methyl]benzonitrile (PubChem CID 133368162) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 4-[[4-(8-methoxy-2-methylquinolin-4-yl)-2-oxopiperazin-1-yl]methyl]benzonitrile.
| Compound Name | 4-[[4-(8-methoxy-2-methylquinolin-4-yl)-2-oxopiperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 133368162 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 4-[[4-(8-methoxy-2-methylquinolin-4-yl)-2-oxopiperazin-1-yl]methyl]benzonitrile |
| SMILES | COc1cccc2c(N3CCN(Cc4ccc(C#N)cc4)C(=O)C3)cc(C)nc12 |
| InChI | InChI=1S/C23H22N4O2/c1-16-12-20(19-4-3-5-21(29-2)23(19)25-16)26-10-11-27(22(28)15-26)14-18-8-6-17(13-24)7-9-18/h3-9,12H,10-11,14-15H2,1-2H3 |
| InChIKey | HJZVOAMEJFNGKJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |