C18H20FN3 — CID 133368181
4-[3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-6-fluoro-2-methylquinoline (PubChem CID 133368181) has the molecular formula C18H20FN3 and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-[3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-6-fluoro-2-methylquinoline.
| Compound Name | 4-[3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-6-fluoro-2-methylquinoline |
|---|---|
| PubChem CID | 133368181 |
| Molecular Formula | C18H20FN3 |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 4-[3-(2,5-dihydropyrrol-1-yl)pyrrolidin-1-yl]-6-fluoro-2-methylquinoline |
| SMILES | Cc1cc(N2CCC(N3CC=CC3)C2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C18H20FN3/c1-13-10-18(16-11-14(19)4-5-17(16)20-13)22-9-6-15(12-22)21-7-2-3-8-21/h2-5,10-11,15H,6-9,12H2,1H3 |
| InChIKey | DOTGVXCGWVSODY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|